About 1-chloroethanol;1-methoxy-4-nitrobenzene
1-chloroethanol;1-methoxy-4-nitrobenzene (PubChem CID 145362894) has the molecular formula C9H12ClNO4
and a molecular weight of 233.65 g/mol. Its IUPAC name is 1-chloroethanol;1-methoxy-4-nitrobenzene.
Molecular Properties
| Compound Name | 1-chloroethanol;1-methoxy-4-nitrobenzene |
| PubChem CID | 145362894 |
| Molecular Formula | C9H12ClNO4 |
| Molecular Weight | 233.65 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 1-chloroethanol;1-methoxy-4-nitrobenzene |
| SMILES | CC(O)Cl.COc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C7H7NO3.C2H5ClO/c1-11-7-4-2-6(3-5-7)8(9)10;1-2(3)4/h2-5H,1H3;2,4H,1H3 |
| InChIKey | DGIQPFSKOZOAQJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.65 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-chloroethanol;1-methoxy-4-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloroethanol;1-methoxy-4-nitrobenzene?
The IUPAC name of 1-chloroethanol;1-methoxy-4-nitrobenzene (CID 145362894) is 1-chloroethanol;1-methoxy-4-nitrobenzene.
What is the SMILES notation for 1-chloroethanol;1-methoxy-4-nitrobenzene?
The canonical SMILES for 1-chloroethanol;1-methoxy-4-nitrobenzene is CC(O)Cl.COc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 1-chloroethanol;1-methoxy-4-nitrobenzene?
The InChIKey is DGIQPFSKOZOAQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3.C2H5ClO/c1-11-7-4-2-6(3-5-7)8(9)10;1-2(3)4/h2-5H,1H3;2,4H,1H3.
What are the key properties of 1-chloroethanol;1-methoxy-4-nitrobenzene?
1-chloroethanol;1-methoxy-4-nitrobenzene has a molecular weight of 233.65 g/mol, XLogP of 2.17, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloroethanol;1-methoxy-4-nitrobenzene is sourced from PubChem (CID 145362894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).