About ethane;3,4,5-trimethyl-1-(oxan-4-ylmethyl)pyrazole
ethane;3,4,5-trimethyl-1-(oxan-4-ylmethyl)pyrazole (PubChem CID 145363929) has the molecular formula C14H26N2O
and a molecular weight of 238.38 g/mol. Its IUPAC name is ethane;3,4,5-trimethyl-1-(oxan-4-ylmethyl)pyrazole.
Molecular Properties
| Compound Name | ethane;3,4,5-trimethyl-1-(oxan-4-ylmethyl)pyrazole |
| PubChem CID | 145363929 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | ethane;3,4,5-trimethyl-1-(oxan-4-ylmethyl)pyrazole |
| SMILES | CC.Cc1nn(CC2CCOCC2)c(C)c1C |
| InChI | InChI=1S/C12H20N2O.C2H6/c1-9-10(2)13-14(11(9)3)8-12-4-6-15-7-5-12;1-2/h12H,4-8H2,1-3H3;1-2H3 |
| InChIKey | GMSIZGAZULFQOP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;3,4,5-trimethyl-1-(oxan-4-ylmethyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3,4,5-trimethyl-1-(oxan-4-ylmethyl)pyrazole?
The IUPAC name of ethane;3,4,5-trimethyl-1-(oxan-4-ylmethyl)pyrazole (CID 145363929) is ethane;3,4,5-trimethyl-1-(oxan-4-ylmethyl)pyrazole.
What is the SMILES notation for ethane;3,4,5-trimethyl-1-(oxan-4-ylmethyl)pyrazole?
The canonical SMILES for ethane;3,4,5-trimethyl-1-(oxan-4-ylmethyl)pyrazole is CC.Cc1nn(CC2CCOCC2)c(C)c1C.
What is the InChIKey of ethane;3,4,5-trimethyl-1-(oxan-4-ylmethyl)pyrazole?
The InChIKey is GMSIZGAZULFQOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O.C2H6/c1-9-10(2)13-14(11(9)3)8-12-4-6-15-7-5-12;1-2/h12H,4-8H2,1-3H3;1-2H3.
What are the key properties of ethane;3,4,5-trimethyl-1-(oxan-4-ylmethyl)pyrazole?
ethane;3,4,5-trimethyl-1-(oxan-4-ylmethyl)pyrazole has a molecular weight of 238.38 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3,4,5-trimethyl-1-(oxan-4-ylmethyl)pyrazole is sourced from PubChem (CID 145363929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).