C19H25N3O — CID 14536422
N-(9-amino-1,2,3,4-tetrahydroacridin-1-yl)hexanamide (PubChem CID 14536422) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is N-(9-amino-1,2,3,4-tetrahydroacridin-1-yl)hexanamide.
| Compound Name | N-(9-amino-1,2,3,4-tetrahydroacridin-1-yl)hexanamide |
|---|---|
| PubChem CID | 14536422 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | N-(9-amino-1,2,3,4-tetrahydroacridin-1-yl)hexanamide |
| SMILES | CCCCCC(=O)NC1CCCc2nc3ccccc3c(N)c21 |
| InChI | InChI=1S/C19H25N3O/c1-2-3-4-12-17(23)22-16-11-7-10-15-18(16)19(20)13-8-5-6-9-14(13)21-15/h5-6,8-9,16H,2-4,7,10-12H2,1H3,(H2,20,21)(H,22,23) |
| InChIKey | JUTRHMRTBXPPIH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|