About ethane;1-methyl-4-[(4,5,6-trimethylpyrimidin-2-yl)methyl]piperazin-2-one
ethane;1-methyl-4-[(4,5,6-trimethylpyrimidin-2-yl)methyl]piperazin-2-one (PubChem CID 145364325) has the molecular formula C15H26N4O
and a molecular weight of 278.40 g/mol. Its IUPAC name is ethane;1-methyl-4-[(4,5,6-trimethylpyrimidin-2-yl)methyl]piperazin-2-one.
Molecular Properties
| Compound Name | ethane;1-methyl-4-[(4,5,6-trimethylpyrimidin-2-yl)methyl]piperazin-2-one |
| PubChem CID | 145364325 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | ethane;1-methyl-4-[(4,5,6-trimethylpyrimidin-2-yl)methyl]piperazin-2-one |
| SMILES | CC.Cc1nc(CN2CCN(C)C(=O)C2)nc(C)c1C |
| InChI | InChI=1S/C13H20N4O.C2H6/c1-9-10(2)14-12(15-11(9)3)7-17-6-5-16(4)13(18)8-17;1-2/h5-8H2,1-4H3;1-2H3 |
| InChIKey | HINJKXKMTKQJAV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;1-methyl-4-[(4,5,6-trimethylpyrimidin-2-yl)methyl]piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-4-[(4,5,6-trimethylpyrimidin-2-yl)methyl]piperazin-2-one?
The IUPAC name of ethane;1-methyl-4-[(4,5,6-trimethylpyrimidin-2-yl)methyl]piperazin-2-one (CID 145364325) is ethane;1-methyl-4-[(4,5,6-trimethylpyrimidin-2-yl)methyl]piperazin-2-one.
What is the SMILES notation for ethane;1-methyl-4-[(4,5,6-trimethylpyrimidin-2-yl)methyl]piperazin-2-one?
The canonical SMILES for ethane;1-methyl-4-[(4,5,6-trimethylpyrimidin-2-yl)methyl]piperazin-2-one is CC.Cc1nc(CN2CCN(C)C(=O)C2)nc(C)c1C.
What is the InChIKey of ethane;1-methyl-4-[(4,5,6-trimethylpyrimidin-2-yl)methyl]piperazin-2-one?
The InChIKey is HINJKXKMTKQJAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O.C2H6/c1-9-10(2)14-12(15-11(9)3)7-17-6-5-16(4)13(18)8-17;1-2/h5-8H2,1-4H3;1-2H3.
What are the key properties of ethane;1-methyl-4-[(4,5,6-trimethylpyrimidin-2-yl)methyl]piperazin-2-one?
ethane;1-methyl-4-[(4,5,6-trimethylpyrimidin-2-yl)methyl]piperazin-2-one has a molecular weight of 278.40 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-4-[(4,5,6-trimethylpyrimidin-2-yl)methyl]piperazin-2-one is sourced from PubChem (CID 145364325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).