C8H6F2N2Se — CID 145364532
5,6-difluoro-4,7-dimethyl-2,1,3-benzoselenadiazole (PubChem CID 145364532) has the molecular formula C8H6F2N2Se and a molecular weight of 247.11 g/mol. Its IUPAC name is 5,6-difluoro-4,7-dimethyl-2,1,3-benzoselenadiazole.
| Compound Name | 5,6-difluoro-4,7-dimethyl-2,1,3-benzoselenadiazole |
|---|---|
| PubChem CID | 145364532 |
| Molecular Formula | C8H6F2N2Se |
| Molecular Weight | 247.11 g/mol |
| Exact Mass | 247.97 |
| IUPAC Name | 5,6-difluoro-4,7-dimethyl-2,1,3-benzoselenadiazole |
| SMILES | Cc1c(F)c(F)c(C)c2n[se]nc12 |
| InChI | InChI=1S/C8H6F2N2Se/c1-3-5(9)6(10)4(2)8-7(3)11-13-12-8/h1-2H3 |
| InChIKey | OJCPQPLPHPYHPQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.11 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|