C12H23N3 — CID 145364890
5-tert-butyl-N-prop-1-en-2-yl-1H-pyrazol-3-amine;ethane (PubChem CID 145364890) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 5-tert-butyl-N-prop-1-en-2-yl-1H-pyrazol-3-amine;ethane.
| Compound Name | 5-tert-butyl-N-prop-1-en-2-yl-1H-pyrazol-3-amine;ethane |
|---|---|
| PubChem CID | 145364890 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 5-tert-butyl-N-prop-1-en-2-yl-1H-pyrazol-3-amine;ethane |
| SMILES | C=C(C)Nc1cc(C(C)(C)C)[nH]n1.CC |
| InChI | InChI=1S/C10H17N3.C2H6/c1-7(2)11-9-6-8(12-13-9)10(3,4)5;1-2/h6H,1H2,2-5H3,(H2,11,12,13);1-2H3 |
| InChIKey | KAOMKEWJUFDHND-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |