About 2-fluoro-6-pyrrolidin-1-yl-1,2-dihydropyridine
2-fluoro-6-pyrrolidin-1-yl-1,2-dihydropyridine (PubChem CID 145365347) has the molecular formula C9H13FN2
and a molecular weight of 168.22 g/mol. Its IUPAC name is 2-fluoro-6-pyrrolidin-1-yl-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 2-fluoro-6-pyrrolidin-1-yl-1,2-dihydropyridine |
| PubChem CID | 145365347 |
| Molecular Formula | C9H13FN2 |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | 2-fluoro-6-pyrrolidin-1-yl-1,2-dihydropyridine |
| SMILES | FC1C=CC=C(N2CCCC2)N1 |
| InChI | InChI=1S/C9H13FN2/c10-8-4-3-5-9(11-8)12-6-1-2-7-12/h3-5,8,11H,1-2,6-7H2 |
| InChIKey | FNBTWFYECRELFX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-6-pyrrolidin-1-yl-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6-pyrrolidin-1-yl-1,2-dihydropyridine?
The IUPAC name of 2-fluoro-6-pyrrolidin-1-yl-1,2-dihydropyridine (CID 145365347) is 2-fluoro-6-pyrrolidin-1-yl-1,2-dihydropyridine.
What is the SMILES notation for 2-fluoro-6-pyrrolidin-1-yl-1,2-dihydropyridine?
The canonical SMILES for 2-fluoro-6-pyrrolidin-1-yl-1,2-dihydropyridine is FC1C=CC=C(N2CCCC2)N1.
What is the InChIKey of 2-fluoro-6-pyrrolidin-1-yl-1,2-dihydropyridine?
The InChIKey is FNBTWFYECRELFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13FN2/c10-8-4-3-5-9(11-8)12-6-1-2-7-12/h3-5,8,11H,1-2,6-7H2.
What are the key properties of 2-fluoro-6-pyrrolidin-1-yl-1,2-dihydropyridine?
2-fluoro-6-pyrrolidin-1-yl-1,2-dihydropyridine has a molecular weight of 168.22 g/mol, XLogP of 1.38, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-pyrrolidin-1-yl-1,2-dihydropyridine is sourced from PubChem (CID 145365347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).