C18H32O2 — CID 145365728
cyclohexanecarbaldehyde;ethane;(3Z,5Z)-2-methoxy-5-methylhepta-1,3,5-triene (PubChem CID 145365728) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is cyclohexanecarbaldehyde;ethane;(3Z,5Z)-2-methoxy-5-methylhepta-1,3,5-triene.
| Compound Name | cyclohexanecarbaldehyde;ethane;(3Z,5Z)-2-methoxy-5-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 145365728 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | cyclohexanecarbaldehyde;ethane;(3Z,5Z)-2-methoxy-5-methylhepta-1,3,5-triene |
| SMILES | C=C(/C=C\C(C)=C/C)OC.CC.O=CC1CCCCC1 |
| InChI | InChI=1S/C9H14O.C7H12O.C2H6/c1-5-8(2)6-7-9(3)10-4;8-6-7-4-2-1-3-5-7;1-2/h5-7H,3H2,1-2,4H3;6-7H,1-5H2;1-2H3/b7-6-,8-5-;; |
| InChIKey | AAGMVBIGKXBQQP-SYQAIZLOSA-N |
| XLogP | 5.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|