C14H24N2O2S — CID 145365795
2-(2-ethoxyethoxy)-N-[[2-(methylideneamino)cyclohexa-1,3-dien-1-yl]sulfanylmethyl]ethanamine (PubChem CID 145365795) has the molecular formula C14H24N2O2S and a molecular weight of 284.43 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)-N-[[2-(methylideneamino)cyclohexa-1,3-dien-1-yl]sulfanylmethyl]ethanamine.
| Compound Name | 2-(2-ethoxyethoxy)-N-[[2-(methylideneamino)cyclohexa-1,3-dien-1-yl]sulfanylmethyl]ethanamine |
|---|---|
| PubChem CID | 145365795 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-(2-ethoxyethoxy)-N-[[2-(methylideneamino)cyclohexa-1,3-dien-1-yl]sulfanylmethyl]ethanamine |
| SMILES | C=NC1=C(SCNCCOCCOCC)CCC=C1 |
| InChI | InChI=1S/C14H24N2O2S/c1-3-17-10-11-18-9-8-16-12-19-14-7-5-4-6-13(14)15-2/h4,6,16H,2-3,5,7-12H2,1H3 |
| InChIKey | NZDFNXJUSBCVJT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|