C14H20F10NOP — CID 145366145
[4-[3-(azepan-1-yl)-2,2,4,4,4-pentafluorobutoxy]-1,1,1,3,3-pentafluorobutan-2-yl]phosphane (PubChem CID 145366145) has the molecular formula C14H20F10NOP and a molecular weight of 439.27 g/mol. Its IUPAC name is [4-[3-(azepan-1-yl)-2,2,4,4,4-pentafluorobutoxy]-1,1,1,3,3-pentafluorobutan-2-yl]phosphane.
| Compound Name | [4-[3-(azepan-1-yl)-2,2,4,4,4-pentafluorobutoxy]-1,1,1,3,3-pentafluorobutan-2-yl]phosphane |
|---|---|
| PubChem CID | 145366145 |
| Molecular Formula | C14H20F10NOP |
| Molecular Weight | 439.27 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | [4-[3-(azepan-1-yl)-2,2,4,4,4-pentafluorobutoxy]-1,1,1,3,3-pentafluorobutan-2-yl]phosphane |
| SMILES | FC(F)(F)C(P)C(F)(F)COCC(F)(F)C(N1CCCCCC1)C(F)(F)F |
| InChI | InChI=1S/C14H20F10NOP/c15-11(16,7-26-8-12(17,18)10(27)14(22,23)24)9(13(19,20)21)25-5-3-1-2-4-6-25/h9-10H,1-8,27H2 |
| InChIKey | LOAGVFNGUJEBGJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.27 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|