C11H16F9NO2 — CID 145366150
2-[ethyl-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]amino]ethanol (PubChem CID 145366150) has the molecular formula C11H16F9NO2 and a molecular weight of 365.24 g/mol. Its IUPAC name is 2-[ethyl-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]amino]ethanol.
| Compound Name | 2-[ethyl-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]amino]ethanol |
|---|---|
| PubChem CID | 145366150 |
| Molecular Formula | C11H16F9NO2 |
| Molecular Weight | 365.24 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 2-[ethyl-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]amino]ethanol |
| SMILES | CCN(CCO)C(F)C(F)(F)COCC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C11H16F9NO2/c1-2-21(3-4-22)8(13)10(16,17)6-23-5-9(14,15)7(12)11(18,19)20/h7-8,22H,2-6H2,1H3 |
| InChIKey | AOUMVWPXIQZESW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.24 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|