C15H24F9NO — CID 145366155
1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-N,N-dipropylbutan-1-amine (PubChem CID 145366155) has the molecular formula C15H24F9NO and a molecular weight of 405.35 g/mol. Its IUPAC name is 1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-N,N-dipropylbutan-1-amine.
| Compound Name | 1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-N,N-dipropylbutan-1-amine |
|---|---|
| PubChem CID | 145366155 |
| Molecular Formula | C15H24F9NO |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-N,N-dipropylbutan-1-amine |
| SMILES | CCCN(CCC)C(F)C(F)(F)C(C)OC(C)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C15H24F9NO/c1-5-7-25(8-6-2)12(17)14(20,21)10(4)26-9(3)13(18,19)11(16)15(22,23)24/h9-12H,5-8H2,1-4H3 |
| InChIKey | LPDNDMKQLBDXAD-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|