C26H32F24N2O3 — CID 145366175
1,1,1-trifluoroethane;1-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]piperidine;4-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]-2-(trifluoromethyl)morpholine (PubChem CID 145366175) has the molecular formula C26H32F24N2O3 and a molecular weight of 876.50 g/mol. Its IUPAC name is 1,1,1-trifluoroethane;1-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]piperidine;4-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]-2-(trifluoromethyl)morpholine.
| Compound Name | 1,1,1-trifluoroethane;1-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]piperidine;4-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]-2-(trifluoromethyl)morpholine |
|---|---|
| PubChem CID | 145366175 |
| Molecular Formula | C26H32F24N2O3 |
| Molecular Weight | 876.50 g/mol |
| Exact Mass | 876.20 |
| IUPAC Name | 1,1,1-trifluoroethane;1-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]piperidine;4-[1,2,2-trifluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)propyl]-2-(trifluoromethyl)morpholine |
| SMILES | CC(F)(F)F.FC(N1CCCCC1)C(F)(F)COCC(F)(F)C(F)C(F)(F)F.FC(N1CCOC(C(F)(F)F)C1)C(F)(F)COCC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C12H13F12NO2.C12H16F9NO.C2H3F3/c13-7(12(22,23)24)9(15,16)4-26-5-10(17,18)8(14)25-1-2-27-6(3-25)11(19,20)21;13-8(12(19,20)21)10(15,16)6-23-7-11(17,18)9(14)22-4-2-1-3-5-22;1-2(3,4)5/h6-8H,1-5H2;8-9H,1-7H2;1H3 |
| InChIKey | JBNSUJACZPJMCH-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.50 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|