C15H22F11NO — CID 145366187
1-[1,2-difluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)-2-(trifluoromethyl)butyl]pyrrolidine;ethane (PubChem CID 145366187) has the molecular formula C15H22F11NO and a molecular weight of 441.33 g/mol. Its IUPAC name is 1-[1,2-difluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)-2-(trifluoromethyl)butyl]pyrrolidine;ethane.
| Compound Name | 1-[1,2-difluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)-2-(trifluoromethyl)butyl]pyrrolidine;ethane |
|---|---|
| PubChem CID | 145366187 |
| Molecular Formula | C15H22F11NO |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 1-[1,2-difluoro-3-(2,2,3,4,4,4-hexafluorobutoxy)-2-(trifluoromethyl)butyl]pyrrolidine;ethane |
| SMILES | CC.CC(OCC(F)(F)C(F)C(F)(F)F)C(F)(C(F)N1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C13H16F11NO.C2H6/c1-7(26-6-10(16,17)8(14)12(19,20)21)11(18,13(22,23)24)9(15)25-4-2-3-5-25;1-2/h7-9H,2-6H2,1H3;1-2H3 |
| InChIKey | FXLQAVKQHPOHFO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|