C28H41N3 — CID 145366485
cyclohexane;ethene;6-[(6-methyl-2,3-dihydropyridin-3-yl)methyl]-4-methylidene-6a,7,8,9,10,10a-hexahydro-3H-benzo[h]quinazoline (PubChem CID 145366485) has the molecular formula C28H41N3 and a molecular weight of 419.66 g/mol. Its IUPAC name is cyclohexane;ethene;6-[(6-methyl-2,3-dihydropyridin-3-yl)methyl]-4-methylidene-6a,7,8,9,10,10a-hexahydro-3H-benzo[h]quinazoline.
| Compound Name | cyclohexane;ethene;6-[(6-methyl-2,3-dihydropyridin-3-yl)methyl]-4-methylidene-6a,7,8,9,10,10a-hexahydro-3H-benzo[h]quinazoline |
|---|---|
| PubChem CID | 145366485 |
| Molecular Formula | C28H41N3 |
| Molecular Weight | 419.66 g/mol |
| Exact Mass | 419.33 |
| IUPAC Name | cyclohexane;ethene;6-[(6-methyl-2,3-dihydropyridin-3-yl)methyl]-4-methylidene-6a,7,8,9,10,10a-hexahydro-3H-benzo[h]quinazoline |
| SMILES | C1CCCCC1.C=C.C=C1NC=NC2=C1C=C(CC1C=CC(C)=NC1)C1CCCCC21 |
| InChI | InChI=1S/C20H25N3.C6H12.C2H4/c1-13-7-8-15(11-21-13)9-16-10-19-14(2)22-12-23-20(19)18-6-4-3-5-17(16)18;1-2-4-6-5-3-1;1-2/h7-8,10,12,15,17-18H,2-6,9,11H2,1H3,(H,22,23);1-6H2;1-2H2 |
| InChIKey | QHPQEGMEJQRMNV-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.66 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|