About 4-amino-1,3-dimethylazepan-2-one;ethane
4-amino-1,3-dimethylazepan-2-one;ethane (PubChem CID 145367314) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is 4-amino-1,3-dimethylazepan-2-one;ethane.
Molecular Properties
| Compound Name | 4-amino-1,3-dimethylazepan-2-one;ethane |
| PubChem CID | 145367314 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 4-amino-1,3-dimethylazepan-2-one;ethane |
| SMILES | CC.CC1C(=O)N(C)CCCC1N |
| InChI | InChI=1S/C8H16N2O.C2H6/c1-6-7(9)4-3-5-10(2)8(6)11;1-2/h6-7H,3-5,9H2,1-2H3;1-2H3 |
| InChIKey | LCXHLUDLROFMHX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-1,3-dimethylazepan-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1,3-dimethylazepan-2-one;ethane?
The IUPAC name of 4-amino-1,3-dimethylazepan-2-one;ethane (CID 145367314) is 4-amino-1,3-dimethylazepan-2-one;ethane.
What is the SMILES notation for 4-amino-1,3-dimethylazepan-2-one;ethane?
The canonical SMILES for 4-amino-1,3-dimethylazepan-2-one;ethane is CC.CC1C(=O)N(C)CCCC1N.
What is the InChIKey of 4-amino-1,3-dimethylazepan-2-one;ethane?
The InChIKey is LCXHLUDLROFMHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O.C2H6/c1-6-7(9)4-3-5-10(2)8(6)11;1-2/h6-7H,3-5,9H2,1-2H3;1-2H3.
What are the key properties of 4-amino-1,3-dimethylazepan-2-one;ethane?
4-amino-1,3-dimethylazepan-2-one;ethane has a molecular weight of 186.30 g/mol, XLogP of 1.23, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1,3-dimethylazepan-2-one;ethane is sourced from PubChem (CID 145367314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).