C21H23Cl2N7O2S — CID 145367609
N-[4-(2-amino-2-oxoethyl)-1-(pyrazin-2-ylamino)sulfanylpiperidin-4-yl]-4,5-dichloro-1-methylindole-2-carboxamide (PubChem CID 145367609) has the molecular formula C21H23Cl2N7O2S and a molecular weight of 508.44 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethyl)-1-(pyrazin-2-ylamino)sulfanylpiperidin-4-yl]-4,5-dichloro-1-methylindole-2-carboxamide.
| Compound Name | N-[4-(2-amino-2-oxoethyl)-1-(pyrazin-2-ylamino)sulfanylpiperidin-4-yl]-4,5-dichloro-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 145367609 |
| Molecular Formula | C21H23Cl2N7O2S |
| Molecular Weight | 508.44 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | N-[4-(2-amino-2-oxoethyl)-1-(pyrazin-2-ylamino)sulfanylpiperidin-4-yl]-4,5-dichloro-1-methylindole-2-carboxamide |
| SMILES | Cn1c(C(=O)NC2(CC(N)=O)CCN(SNc3cnccn3)CC2)cc2c(Cl)c(Cl)ccc21 |
| InChI | InChI=1S/C21H23Cl2N7O2S/c1-29-15-3-2-14(22)19(23)13(15)10-16(29)20(32)27-21(11-17(24)31)4-8-30(9-5-21)33-28-18-12-25-6-7-26-18/h2-3,6-7,10,12H,4-5,8-9,11H2,1H3,(H2,24,31)(H,26,28)(H,27,32) |
| InChIKey | GHCNWOKWTRWTMS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 118.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|