C17H26 — CID 145367667
1-[(1E)-2,3-dimethylbuta-1,3-dienyl]-2,4,5-trimethylbenzene;ethane (PubChem CID 145367667) has the molecular formula C17H26 and a molecular weight of 230.39 g/mol. Its IUPAC name is 1-[(1E)-2,3-dimethylbuta-1,3-dienyl]-2,4,5-trimethylbenzene;ethane.
| Compound Name | 1-[(1E)-2,3-dimethylbuta-1,3-dienyl]-2,4,5-trimethylbenzene;ethane |
|---|---|
| PubChem CID | 145367667 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 1-[(1E)-2,3-dimethylbuta-1,3-dienyl]-2,4,5-trimethylbenzene;ethane |
| SMILES | C=C(C)/C(C)=C/c1cc(C)c(C)cc1C.CC |
| InChI | InChI=1S/C15H20.C2H6/c1-10(2)11(3)8-15-9-13(5)12(4)7-14(15)6;1-2/h7-9H,1H2,2-6H3;1-2H3/b11-8+; |
| InChIKey | SOTNJJSFRLXRCR-YGCVIUNWSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|