C7H10BrN5 — CID 145368007
7-bromoimidazo[2,1-f][1,2,4]triazin-4-amine;ethane (PubChem CID 145368007) has the molecular formula C7H10BrN5 and a molecular weight of 244.10 g/mol. Its IUPAC name is 7-bromoimidazo[2,1-f][1,2,4]triazin-4-amine;ethane.
| Compound Name | 7-bromoimidazo[2,1-f][1,2,4]triazin-4-amine;ethane |
|---|---|
| PubChem CID | 145368007 |
| Molecular Formula | C7H10BrN5 |
| Molecular Weight | 244.10 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | 7-bromoimidazo[2,1-f][1,2,4]triazin-4-amine;ethane |
| SMILES | CC.Nc1ncnn2c(Br)cnc12 |
| InChI | InChI=1S/C5H4BrN5.C2H6/c6-3-1-8-5-4(7)9-2-10-11(3)5;1-2/h1-2H,(H2,7,9,10);1-2H3 |
| InChIKey | BAOIMODRTCNQAI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.10 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |