C25H48O8 — CID 145368377
methanol;(3E,5E)-8,10,11-trimethoxy-1-[3-(3-methoxypentan-2-yl)oxiran-2-yl]-2,6-dimethylundeca-3,5-diene-1,11-diol (PubChem CID 145368377) has the molecular formula C25H48O8 and a molecular weight of 476.65 g/mol. Its IUPAC name is methanol;(3E,5E)-8,10,11-trimethoxy-1-[3-(3-methoxypentan-2-yl)oxiran-2-yl]-2,6-dimethylundeca-3,5-diene-1,11-diol.
| Compound Name | methanol;(3E,5E)-8,10,11-trimethoxy-1-[3-(3-methoxypentan-2-yl)oxiran-2-yl]-2,6-dimethylundeca-3,5-diene-1,11-diol |
|---|---|
| PubChem CID | 145368377 |
| Molecular Formula | C25H48O8 |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.33 |
| IUPAC Name | methanol;(3E,5E)-8,10,11-trimethoxy-1-[3-(3-methoxypentan-2-yl)oxiran-2-yl]-2,6-dimethylundeca-3,5-diene-1,11-diol |
| SMILES | CCC(OC)C(C)C1OC1C(O)C(C)/C=C/C=C(\C)CC(CC(OC)C(O)OC)OC.CO |
| InChI | InChI=1S/C24H44O7.CH4O/c1-9-19(28-6)17(4)22-23(31-22)21(25)16(3)12-10-11-15(2)13-18(27-5)14-20(29-7)24(26)30-8;1-2/h10-12,16-26H,9,13-14H2,1-8H3;2H,1H3/b12-10+,15-11+; |
| InChIKey | XGVGHZHOFOEMRG-FMJMZJACSA-N |
| XLogP | 2.70 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|