C23H42O4 — CID 145368393
(3E,5E)-8-methoxy-1-[2-(3-methoxypentan-2-yl)cyclopropyl]-2,6-dimethylundeca-3,5-diene-1,11-diol (PubChem CID 145368393) has the molecular formula C23H42O4 and a molecular weight of 382.59 g/mol. Its IUPAC name is (3E,5E)-8-methoxy-1-[2-(3-methoxypentan-2-yl)cyclopropyl]-2,6-dimethylundeca-3,5-diene-1,11-diol.
| Compound Name | (3E,5E)-8-methoxy-1-[2-(3-methoxypentan-2-yl)cyclopropyl]-2,6-dimethylundeca-3,5-diene-1,11-diol |
|---|---|
| PubChem CID | 145368393 |
| Molecular Formula | C23H42O4 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | (3E,5E)-8-methoxy-1-[2-(3-methoxypentan-2-yl)cyclopropyl]-2,6-dimethylundeca-3,5-diene-1,11-diol |
| SMILES | CCC(OC)C(C)C1CC1C(O)C(C)/C=C/C=C(\C)CC(CCCO)OC |
| InChI | InChI=1S/C23H42O4/c1-7-22(27-6)18(4)20-15-21(20)23(25)17(3)11-8-10-16(2)14-19(26-5)12-9-13-24/h8,10-11,17-25H,7,9,12-15H2,1-6H3/b11-8+,16-10+ |
| InChIKey | KXSMZSRLRHSEKJ-AIEDVMPDSA-N |
| XLogP | 4.36 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|