C14H10B3ClF3N5O2S — CID 145368526
CID 145368526 (PubChem CID 145368526) has the molecular formula C14H10B3ClF3N5O2S and a molecular weight of 437.22 g/mol.
| Compound Name | CID 145368526 |
|---|---|
| PubChem CID | 145368526 |
| Molecular Formula | C14H10B3ClF3N5O2S |
| Molecular Weight | 437.22 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])C1(c2nc(Cl)c(Nc3ncc(C(F)(F)F)c(NC)n3)s2)CCOC1=O |
| InChI | InChI=1S/C14H10B3ClF3N5O2S/c1-22-7-5(13(19,20)21)4-23-11(25-7)26-8-6(18)24-9(29-8)12(14(15,16)17)2-3-28-10(12)27/h4H,2-3H2,1H3,(H2,22,23,25,26) |
| InChIKey | YWZACIHQQIZGIH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.22 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|