C17H16B3F3N6OS — CID 145368532
CID 145368532 (PubChem CID 145368532) has the molecular formula C17H16B3F3N6OS and a molecular weight of 441.85 g/mol.
| Compound Name | CID 145368532 |
|---|---|
| PubChem CID | 145368532 |
| Molecular Formula | C17H16B3F3N6OS |
| Molecular Weight | 441.85 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])C1(c2nc(C3CC3)c(Nc3ncc(C(F)(F)F)c(NC)n3)s2)CCNC1=O |
| InChI | InChI=1S/C17H16B3F3N6OS/c1-24-10-8(16(21,22)23)6-26-14(28-10)29-11-9(7-2-3-7)27-13(31-11)15(17(18,19)20)4-5-25-12(15)30/h6-7H,2-5H2,1H3,(H,25,30)(H2,24,26,28,29) |
| InChIKey | QDXCSSNZHJUNJA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.85 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|