C15H10B6ClF3N6OS — CID 145368538
CID 145368538 (PubChem CID 145368538) has the molecular formula C15H10B6ClF3N6OS and a molecular weight of 479.67 g/mol.
| Compound Name | CID 145368538 |
|---|---|
| PubChem CID | 145368538 |
| Molecular Formula | C15H10B6ClF3N6OS |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])N1CCC(c2nc(Cl)c(Nc3ncc(C(F)(F)F)c(NC)n3)s2)(C([B])([B])[B])C1=O |
| InChI | InChI=1S/C15H10B6ClF3N6OS/c1-26-7-5(13(23,24)25)4-27-11(29-7)30-8-6(22)28-9(33-8)12(14(16,17)18)2-3-31(10(12)32)15(19,20)21/h4H,2-3H2,1H3,(H2,26,27,29,30) |
| InChIKey | FFDSEUMEKJWFIQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|