C16H12B6ClF3N6OS — CID 145368540
CID 145368540 (PubChem CID 145368540) has the molecular formula C16H12B6ClF3N6OS and a molecular weight of 493.70 g/mol.
| Compound Name | CID 145368540 |
|---|---|
| PubChem CID | 145368540 |
| Molecular Formula | C16H12B6ClF3N6OS |
| Molecular Weight | 493.70 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])N1CCC(c2nc(Cl)c(Nc3ncc(C(F)(F)F)c(NCC)n3)s2)(C([B])([B])[B])C1=O |
| InChI | InChI=1S/C16H12B6ClF3N6OS/c1-2-27-8-6(14(24,25)26)5-28-12(30-8)31-9-7(23)29-10(34-9)13(15(17,18)19)3-4-32(11(13)33)16(20,21)22/h5H,2-4H2,1H3,(H2,27,28,30,31) |
| InChIKey | IRYYSEGVUWMHCM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.70 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|