About ethane;1-(2-ethyl-4,4-difluoropyrrolidin-1-yl)prop-2-en-1-one
ethane;1-(2-ethyl-4,4-difluoropyrrolidin-1-yl)prop-2-en-1-one (PubChem CID 145368573) has the molecular formula C11H19F2NO
and a molecular weight of 219.27 g/mol. Its IUPAC name is ethane;1-(2-ethyl-4,4-difluoropyrrolidin-1-yl)prop-2-en-1-one.
Molecular Properties
| Compound Name | ethane;1-(2-ethyl-4,4-difluoropyrrolidin-1-yl)prop-2-en-1-one |
| PubChem CID | 145368573 |
| Molecular Formula | C11H19F2NO |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | ethane;1-(2-ethyl-4,4-difluoropyrrolidin-1-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(F)(F)CC1CC.CC |
| InChI | InChI=1S/C9H13F2NO.C2H6/c1-3-7-5-9(10,11)6-12(7)8(13)4-2;1-2/h4,7H,2-3,5-6H2,1H3;1-2H3 |
| InChIKey | QNHOJNFNCHTHCN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-(2-ethyl-4,4-difluoropyrrolidin-1-yl)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(2-ethyl-4,4-difluoropyrrolidin-1-yl)prop-2-en-1-one?
The IUPAC name of ethane;1-(2-ethyl-4,4-difluoropyrrolidin-1-yl)prop-2-en-1-one (CID 145368573) is ethane;1-(2-ethyl-4,4-difluoropyrrolidin-1-yl)prop-2-en-1-one.
What is the SMILES notation for ethane;1-(2-ethyl-4,4-difluoropyrrolidin-1-yl)prop-2-en-1-one?
The canonical SMILES for ethane;1-(2-ethyl-4,4-difluoropyrrolidin-1-yl)prop-2-en-1-one is C=CC(=O)N1CC(F)(F)CC1CC.CC.
What is the InChIKey of ethane;1-(2-ethyl-4,4-difluoropyrrolidin-1-yl)prop-2-en-1-one?
The InChIKey is QNHOJNFNCHTHCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2NO.C2H6/c1-3-7-5-9(10,11)6-12(7)8(13)4-2;1-2/h4,7H,2-3,5-6H2,1H3;1-2H3.
What are the key properties of ethane;1-(2-ethyl-4,4-difluoropyrrolidin-1-yl)prop-2-en-1-one?
ethane;1-(2-ethyl-4,4-difluoropyrrolidin-1-yl)prop-2-en-1-one has a molecular weight of 219.27 g/mol, XLogP of 2.84, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(2-ethyl-4,4-difluoropyrrolidin-1-yl)prop-2-en-1-one is sourced from PubChem (CID 145368573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).