C11H19F2NO — CID 145368573
ethane;1-(2-ethyl-4,4-difluoropyrrolidin-1-yl)prop-2-en-1-one (PubChem CID 145368573) has the molecular formula C11H19F2NO and a molecular weight of 219.27 g/mol. Its IUPAC name is ethane;1-(2-ethyl-4,4-difluoropyrrolidin-1-yl)prop-2-en-1-one.
| Compound Name | ethane;1-(2-ethyl-4,4-difluoropyrrolidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 145368573 |
| Molecular Formula | C11H19F2NO |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | ethane;1-(2-ethyl-4,4-difluoropyrrolidin-1-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(F)(F)CC1CC.CC |
| InChI | InChI=1S/C9H13F2NO.C2H6/c1-3-7-5-9(10,11)6-12(7)8(13)4-2;1-2/h4,7H,2-3,5-6H2,1H3;1-2H3 |
| InChIKey | QNHOJNFNCHTHCN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|