C29H29FN2OS — CID 145369079
N-[(4-ethylsulfanylphenyl)methyl]-2-[(2-fluoro-4-methylphenyl)methyl]-1-prop-2-enylindole-5-carboxamide (PubChem CID 145369079) has the molecular formula C29H29FN2OS and a molecular weight of 472.63 g/mol. Its IUPAC name is N-[(4-ethylsulfanylphenyl)methyl]-2-[(2-fluoro-4-methylphenyl)methyl]-1-prop-2-enylindole-5-carboxamide.
| Compound Name | N-[(4-ethylsulfanylphenyl)methyl]-2-[(2-fluoro-4-methylphenyl)methyl]-1-prop-2-enylindole-5-carboxamide |
|---|---|
| PubChem CID | 145369079 |
| Molecular Formula | C29H29FN2OS |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | N-[(4-ethylsulfanylphenyl)methyl]-2-[(2-fluoro-4-methylphenyl)methyl]-1-prop-2-enylindole-5-carboxamide |
| SMILES | C=CCn1c(Cc2ccc(C)cc2F)cc2cc(C(=O)NCc3ccc(SCC)cc3)ccc21 |
| InChI | InChI=1S/C29H29FN2OS/c1-4-14-32-25(17-22-9-6-20(3)15-27(22)30)18-24-16-23(10-13-28(24)32)29(33)31-19-21-7-11-26(12-8-21)34-5-2/h4,6-13,15-16,18H,1,5,14,17,19H2,2-3H3,(H,31,33) |
| InChIKey | UZHLZXIPVWQNKR-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|