C13H19NO2 — CID 145369355
(3E,5Z)-3-ethenyl-1-morpholin-4-ylhepta-3,5-dien-2-one (PubChem CID 145369355) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (3E,5Z)-3-ethenyl-1-morpholin-4-ylhepta-3,5-dien-2-one.
| Compound Name | (3E,5Z)-3-ethenyl-1-morpholin-4-ylhepta-3,5-dien-2-one |
|---|---|
| PubChem CID | 145369355 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (3E,5Z)-3-ethenyl-1-morpholin-4-ylhepta-3,5-dien-2-one |
| SMILES | C=C/C(=C\C=C/C)C(=O)CN1CCOCC1 |
| InChI | InChI=1S/C13H19NO2/c1-3-5-6-12(4-2)13(15)11-14-7-9-16-10-8-14/h3-6H,2,7-11H2,1H3/b5-3-,12-6+ |
| InChIKey | RWEWBEWVPACFFP-YXMBOXQASA-N |
| XLogP | 1.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|