C10H20N2S — CID 145369418
2-sulfanyl-2,10-diazabicyclo[5.5.0]dodecane (PubChem CID 145369418) has the molecular formula C10H20N2S and a molecular weight of 200.35 g/mol. Its IUPAC name is 2-sulfanyl-2,10-diazabicyclo[5.5.0]dodecane.
| Compound Name | 2-sulfanyl-2,10-diazabicyclo[5.5.0]dodecane |
|---|---|
| PubChem CID | 145369418 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-sulfanyl-2,10-diazabicyclo[5.5.0]dodecane |
| SMILES | SN1CCCCC2CCNCCC21 |
| InChI | InChI=1S/C10H20N2S/c13-12-8-2-1-3-9-4-6-11-7-5-10(9)12/h9-11,13H,1-8H2 |
| InChIKey | BYQTZZYGUWEEMB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|