About 2-sulfanyl-2,10-diazabicyclo[5.5.0]dodecane
2-sulfanyl-2,10-diazabicyclo[5.5.0]dodecane (PubChem CID 145369418) has the molecular formula C10H20N2S
and a molecular weight of 200.35 g/mol. Its IUPAC name is 2-sulfanyl-2,10-diazabicyclo[5.5.0]dodecane.
Molecular Properties
| Compound Name | 2-sulfanyl-2,10-diazabicyclo[5.5.0]dodecane |
| PubChem CID | 145369418 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-sulfanyl-2,10-diazabicyclo[5.5.0]dodecane |
| SMILES | SN1CCCCC2CCNCCC21 |
| InChI | InChI=1S/C10H20N2S/c13-12-8-2-1-3-9-4-6-11-7-5-10(9)12/h9-11,13H,1-8H2 |
| InChIKey | BYQTZZYGUWEEMB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanyl-2,10-diazabicyclo[5.5.0]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanyl-2,10-diazabicyclo[5.5.0]dodecane?
The IUPAC name of 2-sulfanyl-2,10-diazabicyclo[5.5.0]dodecane (CID 145369418) is 2-sulfanyl-2,10-diazabicyclo[5.5.0]dodecane.
What is the SMILES notation for 2-sulfanyl-2,10-diazabicyclo[5.5.0]dodecane?
The canonical SMILES for 2-sulfanyl-2,10-diazabicyclo[5.5.0]dodecane is SN1CCCCC2CCNCCC21.
What is the InChIKey of 2-sulfanyl-2,10-diazabicyclo[5.5.0]dodecane?
The InChIKey is BYQTZZYGUWEEMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2S/c13-12-8-2-1-3-9-4-6-11-7-5-10(9)12/h9-11,13H,1-8H2.
What are the key properties of 2-sulfanyl-2,10-diazabicyclo[5.5.0]dodecane?
2-sulfanyl-2,10-diazabicyclo[5.5.0]dodecane has a molecular weight of 200.35 g/mol, XLogP of 1.69, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanyl-2,10-diazabicyclo[5.5.0]dodecane is sourced from PubChem (CID 145369418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).