C19H27N — CID 145369488
4,4-dimethyl-2-(4,6,6-trimethylocta-1,4,7-trien-3-yl)azepine (PubChem CID 145369488) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is 4,4-dimethyl-2-(4,6,6-trimethylocta-1,4,7-trien-3-yl)azepine.
| Compound Name | 4,4-dimethyl-2-(4,6,6-trimethylocta-1,4,7-trien-3-yl)azepine |
|---|---|
| PubChem CID | 145369488 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 4,4-dimethyl-2-(4,6,6-trimethylocta-1,4,7-trien-3-yl)azepine |
| SMILES | C=CC(C(C)=CC(C)(C)C=C)C1=CC(C)(C)C=CC=N1 |
| InChI | InChI=1S/C19H27N/c1-8-16(15(3)13-18(4,5)9-2)17-14-19(6,7)11-10-12-20-17/h8-14,16H,1-2H2,3-7H3 |
| InChIKey | IFJKDPHUTFUKQK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|