C26H32 — CID 145370760
5-[(3E,5E)-5-ethylideneocta-1,3-dien-6-yn-3-yl]-3,3-dimethylspiro[1H-indene-2,1'-cyclohexane] (PubChem CID 145370760) has the molecular formula C26H32 and a molecular weight of 344.54 g/mol. Its IUPAC name is 5-[(3E,5E)-5-ethylideneocta-1,3-dien-6-yn-3-yl]-3,3-dimethylspiro[1H-indene-2,1'-cyclohexane].
| Compound Name | 5-[(3E,5E)-5-ethylideneocta-1,3-dien-6-yn-3-yl]-3,3-dimethylspiro[1H-indene-2,1'-cyclohexane] |
|---|---|
| PubChem CID | 145370760 |
| Molecular Formula | C26H32 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 5-[(3E,5E)-5-ethylideneocta-1,3-dien-6-yn-3-yl]-3,3-dimethylspiro[1H-indene-2,1'-cyclohexane] |
| SMILES | C=C/C(=C\C(C#CC)=C/C)c1ccc2c(c1)C(C)(C)C1(CCCCC1)C2 |
| InChI | InChI=1S/C26H32/c1-6-12-20(7-2)17-21(8-3)22-13-14-23-19-26(15-10-9-11-16-26)25(4,5)24(23)18-22/h7-8,13-14,17-18H,3,9-11,15-16,19H2,1-2,4-5H3/b20-7-,21-17+ |
| InChIKey | CLZGZTMAFPEARA-XJHGOXEASA-N |
| XLogP | 7.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|