C12H9Cl2NS — CID 14537090
7,10-dichloro-3,4-dihydro-1H-thiopyrano[4,3-b]quinoline (PubChem CID 14537090) has the molecular formula C12H9Cl2NS and a molecular weight of 270.18 g/mol. Its IUPAC name is 7,10-dichloro-3,4-dihydro-1H-thiopyrano[4,3-b]quinoline.
| Compound Name | 7,10-dichloro-3,4-dihydro-1H-thiopyrano[4,3-b]quinoline |
|---|---|
| PubChem CID | 14537090 |
| Molecular Formula | C12H9Cl2NS |
| Molecular Weight | 270.18 g/mol |
| Exact Mass | 268.98 |
| IUPAC Name | 7,10-dichloro-3,4-dihydro-1H-thiopyrano[4,3-b]quinoline |
| SMILES | Clc1ccc2c(Cl)c3c(nc2c1)CCSC3 |
| InChI | InChI=1S/C12H9Cl2NS/c13-7-1-2-8-11(5-7)15-10-3-4-16-6-9(10)12(8)14/h1-2,5H,3-4,6H2 |
| InChIKey | FBLTYGOTYLNSNY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.18 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |