About 5-methyl-3-propyl-1,3,2-oxazaphospholidine
5-methyl-3-propyl-1,3,2-oxazaphospholidine (PubChem CID 145370933) has the molecular formula C6H14NOP
and a molecular weight of 147.16 g/mol. Its IUPAC name is 5-methyl-3-propyl-1,3,2-oxazaphospholidine.
Molecular Properties
| Compound Name | 5-methyl-3-propyl-1,3,2-oxazaphospholidine |
| PubChem CID | 145370933 |
| Molecular Formula | C6H14NOP |
| Molecular Weight | 147.16 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 5-methyl-3-propyl-1,3,2-oxazaphospholidine |
| SMILES | CCCN1CC(C)OP1 |
| InChI | InChI=1S/C6H14NOP/c1-3-4-7-5-6(2)8-9-7/h6,9H,3-5H2,1-2H3 |
| InChIKey | WPKLILLIZJBTJE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.16 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-3-propyl-1,3,2-oxazaphospholidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-propyl-1,3,2-oxazaphospholidine?
The IUPAC name of 5-methyl-3-propyl-1,3,2-oxazaphospholidine (CID 145370933) is 5-methyl-3-propyl-1,3,2-oxazaphospholidine.
What is the SMILES notation for 5-methyl-3-propyl-1,3,2-oxazaphospholidine?
The canonical SMILES for 5-methyl-3-propyl-1,3,2-oxazaphospholidine is CCCN1CC(C)OP1.
What is the InChIKey of 5-methyl-3-propyl-1,3,2-oxazaphospholidine?
The InChIKey is WPKLILLIZJBTJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14NOP/c1-3-4-7-5-6(2)8-9-7/h6,9H,3-5H2,1-2H3.
What are the key properties of 5-methyl-3-propyl-1,3,2-oxazaphospholidine?
5-methyl-3-propyl-1,3,2-oxazaphospholidine has a molecular weight of 147.16 g/mol, XLogP of 1.63, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-propyl-1,3,2-oxazaphospholidine is sourced from PubChem (CID 145370933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).