C14H16N2 — CID 145370953
2,3,4,7-tetrahydro-1H-cyclohepta[b]quinolin-11-amine (PubChem CID 145370953) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 2,3,4,7-tetrahydro-1H-cyclohepta[b]quinolin-11-amine.
| Compound Name | 2,3,4,7-tetrahydro-1H-cyclohepta[b]quinolin-11-amine |
|---|---|
| PubChem CID | 145370953 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 2,3,4,7-tetrahydro-1H-cyclohepta[b]quinolin-11-amine |
| SMILES | Nc1c2c(nc3c1=CC=CCC=3)CCCC2 |
| InChI | InChI=1S/C14H16N2/c15-14-10-6-2-1-3-8-12(10)16-13-9-5-4-7-11(13)14/h1-2,6,8H,3-5,7,9,15H2 |
| InChIKey | UNWIWZXHDWBVMK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |