C14H16FN — CID 145370986
7-fluoro-1,1-dimethyl-3-propa-1,2-dienyl-2,3-dihydroinden-4-amine (PubChem CID 145370986) has the molecular formula C14H16FN and a molecular weight of 217.29 g/mol. Its IUPAC name is 7-fluoro-1,1-dimethyl-3-propa-1,2-dienyl-2,3-dihydroinden-4-amine.
| Compound Name | 7-fluoro-1,1-dimethyl-3-propa-1,2-dienyl-2,3-dihydroinden-4-amine |
|---|---|
| PubChem CID | 145370986 |
| Molecular Formula | C14H16FN |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 7-fluoro-1,1-dimethyl-3-propa-1,2-dienyl-2,3-dihydroinden-4-amine |
| SMILES | C=C=CC1CC(C)(C)c2c(F)ccc(N)c21 |
| InChI | InChI=1S/C14H16FN/c1-4-5-9-8-14(2,3)13-10(15)6-7-11(16)12(9)13/h5-7,9H,1,8,16H2,2-3H3 |
| InChIKey | KQDGXEAVNIOGIW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|