C29H34F3N7O2 — CID 145370995
methyl 2-[[3-(1,1-diamino-2,2,2-trifluoroethyl)phenyl]methyl]-4-(3-piperidin-1-ylpropylamino)-9H-pyrimido[4,5-b]indole-7-carboxylate (PubChem CID 145370995) has the molecular formula C29H34F3N7O2 and a molecular weight of 569.63 g/mol. Its IUPAC name is methyl 2-[[3-(1,1-diamino-2,2,2-trifluoroethyl)phenyl]methyl]-4-(3-piperidin-1-ylpropylamino)-9H-pyrimido[4,5-b]indole-7-carboxylate.
| Compound Name | methyl 2-[[3-(1,1-diamino-2,2,2-trifluoroethyl)phenyl]methyl]-4-(3-piperidin-1-ylpropylamino)-9H-pyrimido[4,5-b]indole-7-carboxylate |
|---|---|
| PubChem CID | 145370995 |
| Molecular Formula | C29H34F3N7O2 |
| Molecular Weight | 569.63 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | methyl 2-[[3-(1,1-diamino-2,2,2-trifluoroethyl)phenyl]methyl]-4-(3-piperidin-1-ylpropylamino)-9H-pyrimido[4,5-b]indole-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[nH]c1nc(Cc3cccc(C(N)(N)C(F)(F)F)c3)nc(NCCCN3CCCCC3)c12 |
| InChI | InChI=1S/C29H34F3N7O2/c1-41-27(40)19-9-10-21-22(17-19)36-26-24(21)25(35-11-6-14-39-12-3-2-4-13-39)37-23(38-26)16-18-7-5-8-20(15-18)28(33,34)29(30,31)32/h5,7-10,15,17H,2-4,6,11-14,16,33-34H2,1H3,(H2,35,36,37,38) |
| InChIKey | ONVPIVFKUICFFE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 135.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.63 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|