About 2-(4-methylphenyl)-1,3-dihydroisoindole;2-methylpyrido[3,4-d]pyrimidine
2-(4-methylphenyl)-1,3-dihydroisoindole;2-methylpyrido[3,4-d]pyrimidine (PubChem CID 145371108) has the molecular formula C23H22N4
and a molecular weight of 354.46 g/mol. Its IUPAC name is 2-(4-methylphenyl)-1,3-dihydroisoindole;2-methylpyrido[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)-1,3-dihydroisoindole;2-methylpyrido[3,4-d]pyrimidine |
| PubChem CID | 145371108 |
| Molecular Formula | C23H22N4 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 2-(4-methylphenyl)-1,3-dihydroisoindole;2-methylpyrido[3,4-d]pyrimidine |
| SMILES | Cc1ccc(N2Cc3ccccc3C2)cc1.Cc1ncc2ccncc2n1 |
| InChI | InChI=1S/C15H15N.C8H7N3/c1-12-6-8-15(9-7-12)16-10-13-4-2-3-5-14(13)11-16;1-6-10-4-7-2-3-9-5-8(7)11-6/h2-9H,10-11H2,1H3;2-5H,1H3 |
| InChIKey | YPFSJENEBQRUQE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methylphenyl)-1,3-dihydroisoindole;2-methylpyrido[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)-1,3-dihydroisoindole;2-methylpyrido[3,4-d]pyrimidine?
The IUPAC name of 2-(4-methylphenyl)-1,3-dihydroisoindole;2-methylpyrido[3,4-d]pyrimidine (CID 145371108) is 2-(4-methylphenyl)-1,3-dihydroisoindole;2-methylpyrido[3,4-d]pyrimidine.
What is the SMILES notation for 2-(4-methylphenyl)-1,3-dihydroisoindole;2-methylpyrido[3,4-d]pyrimidine?
The canonical SMILES for 2-(4-methylphenyl)-1,3-dihydroisoindole;2-methylpyrido[3,4-d]pyrimidine is Cc1ccc(N2Cc3ccccc3C2)cc1.Cc1ncc2ccncc2n1.
What is the InChIKey of 2-(4-methylphenyl)-1,3-dihydroisoindole;2-methylpyrido[3,4-d]pyrimidine?
The InChIKey is YPFSJENEBQRUQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N.C8H7N3/c1-12-6-8-15(9-7-12)16-10-13-4-2-3-5-14(13)11-16;1-6-10-4-7-2-3-9-5-8(7)11-6/h2-9H,10-11H2,1H3;2-5H,1H3.
What are the key properties of 2-(4-methylphenyl)-1,3-dihydroisoindole;2-methylpyrido[3,4-d]pyrimidine?
2-(4-methylphenyl)-1,3-dihydroisoindole;2-methylpyrido[3,4-d]pyrimidine has a molecular weight of 354.46 g/mol, XLogP of 4.85, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)-1,3-dihydroisoindole;2-methylpyrido[3,4-d]pyrimidine is sourced from PubChem (CID 145371108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).