About N-acetyl-2-(1,3-dioxo-5,6-dihydroisoindol-2-yl)-N-methylpropanamide
N-acetyl-2-(1,3-dioxo-5,6-dihydroisoindol-2-yl)-N-methylpropanamide (PubChem CID 145371603) has the molecular formula C14H16N2O4
and a molecular weight of 276.29 g/mol. Its IUPAC name is N-acetyl-2-(1,3-dioxo-5,6-dihydroisoindol-2-yl)-N-methylpropanamide.
Molecular Properties
| Compound Name | N-acetyl-2-(1,3-dioxo-5,6-dihydroisoindol-2-yl)-N-methylpropanamide |
| PubChem CID | 145371603 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N-acetyl-2-(1,3-dioxo-5,6-dihydroisoindol-2-yl)-N-methylpropanamide |
| SMILES | CC(=O)N(C)C(=O)C(C)N1C(=O)C2=CCCC=C2C1=O |
| InChI | InChI=1S/C14H16N2O4/c1-8(12(18)15(3)9(2)17)16-13(19)10-6-4-5-7-11(10)14(16)20/h6-8H,4-5H2,1-3H3 |
| InChIKey | SOGRCSUQXJVWJM-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-acetyl-2-(1,3-dioxo-5,6-dihydroisoindol-2-yl)-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetyl-2-(1,3-dioxo-5,6-dihydroisoindol-2-yl)-N-methylpropanamide?
The IUPAC name of N-acetyl-2-(1,3-dioxo-5,6-dihydroisoindol-2-yl)-N-methylpropanamide (CID 145371603) is N-acetyl-2-(1,3-dioxo-5,6-dihydroisoindol-2-yl)-N-methylpropanamide.
What is the SMILES notation for N-acetyl-2-(1,3-dioxo-5,6-dihydroisoindol-2-yl)-N-methylpropanamide?
The canonical SMILES for N-acetyl-2-(1,3-dioxo-5,6-dihydroisoindol-2-yl)-N-methylpropanamide is CC(=O)N(C)C(=O)C(C)N1C(=O)C2=CCCC=C2C1=O.
What is the InChIKey of N-acetyl-2-(1,3-dioxo-5,6-dihydroisoindol-2-yl)-N-methylpropanamide?
The InChIKey is SOGRCSUQXJVWJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O4/c1-8(12(18)15(3)9(2)17)16-13(19)10-6-4-5-7-11(10)14(16)20/h6-8H,4-5H2,1-3H3.
What are the key properties of N-acetyl-2-(1,3-dioxo-5,6-dihydroisoindol-2-yl)-N-methylpropanamide?
N-acetyl-2-(1,3-dioxo-5,6-dihydroisoindol-2-yl)-N-methylpropanamide has a molecular weight of 276.29 g/mol, XLogP of 0.40, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetyl-2-(1,3-dioxo-5,6-dihydroisoindol-2-yl)-N-methylpropanamide is sourced from PubChem (CID 145371603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).