C27H34N6O — CID 145371767
6-hydrazinyl-4-(1-phenyl-4-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylbutyl)pyridine-2,5-diamine (PubChem CID 145371767) has the molecular formula C27H34N6O and a molecular weight of 458.61 g/mol. Its IUPAC name is 6-hydrazinyl-4-(1-phenyl-4-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylbutyl)pyridine-2,5-diamine.
| Compound Name | 6-hydrazinyl-4-(1-phenyl-4-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylbutyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 145371767 |
| Molecular Formula | C27H34N6O |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | 6-hydrazinyl-4-(1-phenyl-4-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylbutyl)pyridine-2,5-diamine |
| SMILES | NNc1nc(N)cc(C(CCCN2CCC3(CC2)OCc2ccccc23)c2ccccc2)c1N |
| InChI | InChI=1S/C27H34N6O/c28-24-17-22(25(29)26(31-24)32-30)21(19-7-2-1-3-8-19)10-6-14-33-15-12-27(13-16-33)23-11-5-4-9-20(23)18-34-27/h1-5,7-9,11,17,21H,6,10,12-16,18,29-30H2,(H3,28,31,32) |
| InChIKey | DMMSFGXJLQXXOZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|