C17H27NS — CID 145371787
2-methylpropane;N-[(3R)-3-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalen-1-yl]thiohydroxylamine (PubChem CID 145371787) has the molecular formula C17H27NS and a molecular weight of 277.48 g/mol. Its IUPAC name is 2-methylpropane;N-[(3R)-3-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalen-1-yl]thiohydroxylamine.
| Compound Name | 2-methylpropane;N-[(3R)-3-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalen-1-yl]thiohydroxylamine |
|---|---|
| PubChem CID | 145371787 |
| Molecular Formula | C17H27NS |
| Molecular Weight | 277.48 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 2-methylpropane;N-[(3R)-3-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalen-1-yl]thiohydroxylamine |
| SMILES | C=C(C)[C@@H]1Cc2ccccc2C(NS)C1.CC(C)C |
| InChI | InChI=1S/C13H17NS.C4H10/c1-9(2)11-7-10-5-3-4-6-12(10)13(8-11)14-15;1-4(2)3/h3-6,11,13-15H,1,7-8H2,2H3;4H,1-3H3/t11-,13?;/m1./s1 |
| InChIKey | KXHMEOPITUGCOE-ZRMPQGGQSA-N |
| XLogP | 4.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|