About benzene;ethyl N-cyclohexylcarbamate
benzene;ethyl N-cyclohexylcarbamate (PubChem CID 145371833) has the molecular formula C15H23NO2
and a molecular weight of 249.35 g/mol. Its IUPAC name is benzene;ethyl N-cyclohexylcarbamate.
Molecular Properties
| Compound Name | benzene;ethyl N-cyclohexylcarbamate |
| PubChem CID | 145371833 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | benzene;ethyl N-cyclohexylcarbamate |
| SMILES | CCOC(=O)NC1CCCCC1.c1ccccc1 |
| InChI | InChI=1S/C9H17NO2.C6H6/c1-2-12-9(11)10-8-6-4-3-5-7-8;1-2-4-6-5-3-1/h8H,2-7H2,1H3,(H,10,11);1-6H |
| InChIKey | BCYCNDIMCALJHL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene;ethyl N-cyclohexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;ethyl N-cyclohexylcarbamate?
The IUPAC name of benzene;ethyl N-cyclohexylcarbamate (CID 145371833) is benzene;ethyl N-cyclohexylcarbamate.
What is the SMILES notation for benzene;ethyl N-cyclohexylcarbamate?
The canonical SMILES for benzene;ethyl N-cyclohexylcarbamate is CCOC(=O)NC1CCCCC1.c1ccccc1.
What is the InChIKey of benzene;ethyl N-cyclohexylcarbamate?
The InChIKey is BCYCNDIMCALJHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.C6H6/c1-2-12-9(11)10-8-6-4-3-5-7-8;1-2-4-6-5-3-1/h8H,2-7H2,1H3,(H,10,11);1-6H.
What are the key properties of benzene;ethyl N-cyclohexylcarbamate?
benzene;ethyl N-cyclohexylcarbamate has a molecular weight of 249.35 g/mol, XLogP of 3.75, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;ethyl N-cyclohexylcarbamate is sourced from PubChem (CID 145371833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).