C11H20N2O6Pt — CID 14537213
2,2-bis(aminomethyl)propane-1,3-diol;cyclobutane-1,1-dicarboxylate;platinum(2+) (PubChem CID 14537213) has the molecular formula C11H20N2O6Pt and a molecular weight of 471.37 g/mol. Its IUPAC name is 2,2-bis(aminomethyl)propane-1,3-diol;cyclobutane-1,1-dicarboxylate;platinum(2+).
| Compound Name | 2,2-bis(aminomethyl)propane-1,3-diol;cyclobutane-1,1-dicarboxylate;platinum(2+) |
|---|---|
| PubChem CID | 14537213 |
| Molecular Formula | C11H20N2O6Pt |
| Molecular Weight | 471.37 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 2,2-bis(aminomethyl)propane-1,3-diol;cyclobutane-1,1-dicarboxylate;platinum(2+) |
| SMILES | NCC(CN)(CO)CO.O=C([O-])C1(C(=O)[O-])CCC1.[Pt+2] |
| InChI | InChI=1S/C6H8O4.C5H14N2O2.Pt/c7-4(8)6(5(9)10)2-1-3-6;6-1-5(2-7,3-8)4-9;/h1-3H2,(H,7,8)(H,9,10);8-9H,1-4,6-7H2;/q;;+2/p-2 |
| InChIKey | NKUWPVYXJNSCQL-UHFFFAOYSA-L |
| XLogP | -4.47 |
| TPSA | 172.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.37 |
| LogP ≤ 5 | -4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|