C6H11N3O — CID 145372236
1-(C,N-dimethylcarbonimidoyl)imidazolidin-2-one (PubChem CID 145372236) has the molecular formula C6H11N3O and a molecular weight of 141.17 g/mol. Its IUPAC name is 1-(C,N-dimethylcarbonimidoyl)imidazolidin-2-one.
| Compound Name | 1-(C,N-dimethylcarbonimidoyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 145372236 |
| Molecular Formula | C6H11N3O |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.09 |
| IUPAC Name | 1-(C,N-dimethylcarbonimidoyl)imidazolidin-2-one |
| SMILES | C/N=C(\C)N1CCNC1=O |
| InChI | InChI=1S/C6H11N3O/c1-5(7-2)9-4-3-8-6(9)10/h3-4H2,1-2H3,(H,8,10)/b7-5+ |
| InChIKey | KIXDZPGFPFGWBM-FNORWQNLSA-N |
| XLogP | 0.06 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|