About 2-phenyl-3,3-bis(4-propan-2-yloxyphenyl)prop-2-enenitrile
2-phenyl-3,3-bis(4-propan-2-yloxyphenyl)prop-2-enenitrile (PubChem CID 14537250) has the molecular formula C27H27NO2
and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-phenyl-3,3-bis(4-propan-2-yloxyphenyl)prop-2-enenitrile.
Molecular Properties
| Compound Name | 2-phenyl-3,3-bis(4-propan-2-yloxyphenyl)prop-2-enenitrile |
| PubChem CID | 14537250 |
| Molecular Formula | C27H27NO2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 2-phenyl-3,3-bis(4-propan-2-yloxyphenyl)prop-2-enenitrile |
| SMILES | CC(C)Oc1ccc(C(=C(C#N)c2ccccc2)c2ccc(OC(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H27NO2/c1-19(2)29-24-14-10-22(11-15-24)27(26(18-28)21-8-6-5-7-9-21)23-12-16-25(17-13-23)30-20(3)4/h5-17,19-20H,1-4H3 |
| InChIKey | ARCVEEHMIKOWCZ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-3,3-bis(4-propan-2-yloxyphenyl)prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-3,3-bis(4-propan-2-yloxyphenyl)prop-2-enenitrile?
The IUPAC name of 2-phenyl-3,3-bis(4-propan-2-yloxyphenyl)prop-2-enenitrile (CID 14537250) is 2-phenyl-3,3-bis(4-propan-2-yloxyphenyl)prop-2-enenitrile.
What is the SMILES notation for 2-phenyl-3,3-bis(4-propan-2-yloxyphenyl)prop-2-enenitrile?
The canonical SMILES for 2-phenyl-3,3-bis(4-propan-2-yloxyphenyl)prop-2-enenitrile is CC(C)Oc1ccc(C(=C(C#N)c2ccccc2)c2ccc(OC(C)C)cc2)cc1.
What is the InChIKey of 2-phenyl-3,3-bis(4-propan-2-yloxyphenyl)prop-2-enenitrile?
The InChIKey is ARCVEEHMIKOWCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H27NO2/c1-19(2)29-24-14-10-22(11-15-24)27(26(18-28)21-8-6-5-7-9-21)23-12-16-25(17-13-23)30-20(3)4/h5-17,19-20H,1-4H3.
What are the key properties of 2-phenyl-3,3-bis(4-propan-2-yloxyphenyl)prop-2-enenitrile?
2-phenyl-3,3-bis(4-propan-2-yloxyphenyl)prop-2-enenitrile has a molecular weight of 397.52 g/mol, XLogP of 6.74, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-3,3-bis(4-propan-2-yloxyphenyl)prop-2-enenitrile is sourced from PubChem (CID 14537250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).