About (2-methylcyclopenta-2,4-dien-1-yl)-bis(2-methylpropyl)alumane
(2-methylcyclopenta-2,4-dien-1-yl)-bis(2-methylpropyl)alumane (PubChem CID 145373365) has the molecular formula C14H25Al
and a molecular weight of 220.34 g/mol. Its IUPAC name is (2-methylcyclopenta-2,4-dien-1-yl)-bis(2-methylpropyl)alumane.
Molecular Properties
| Compound Name | (2-methylcyclopenta-2,4-dien-1-yl)-bis(2-methylpropyl)alumane |
| PubChem CID | 145373365 |
| Molecular Formula | C14H25Al |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (2-methylcyclopenta-2,4-dien-1-yl)-bis(2-methylpropyl)alumane |
| SMILES | CC1=CC=CC1[Al](CC(C)C)CC(C)C |
| InChI | InChI=1S/C6H7.2C4H9.Al/c1-6-4-2-3-5-6;2*1-4(2)3;/h2-5H,1H3;2*4H,1H2,2-3H3; |
| InChIKey | XRIGRRMVAKHXJF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (2-methylcyclopenta-2,4-dien-1-yl)-bis(2-methylpropyl)alumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylcyclopenta-2,4-dien-1-yl)-bis(2-methylpropyl)alumane?
The IUPAC name of (2-methylcyclopenta-2,4-dien-1-yl)-bis(2-methylpropyl)alumane (CID 145373365) is (2-methylcyclopenta-2,4-dien-1-yl)-bis(2-methylpropyl)alumane.
What is the SMILES notation for (2-methylcyclopenta-2,4-dien-1-yl)-bis(2-methylpropyl)alumane?
The canonical SMILES for (2-methylcyclopenta-2,4-dien-1-yl)-bis(2-methylpropyl)alumane is CC1=CC=CC1[Al](CC(C)C)CC(C)C.
What is the InChIKey of (2-methylcyclopenta-2,4-dien-1-yl)-bis(2-methylpropyl)alumane?
The InChIKey is XRIGRRMVAKHXJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7.2C4H9.Al/c1-6-4-2-3-5-6;2*1-4(2)3;/h2-5H,1H3;2*4H,1H2,2-3H3;.
What are the key properties of (2-methylcyclopenta-2,4-dien-1-yl)-bis(2-methylpropyl)alumane?
(2-methylcyclopenta-2,4-dien-1-yl)-bis(2-methylpropyl)alumane has a molecular weight of 220.34 g/mol, XLogP of 4.68, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylcyclopenta-2,4-dien-1-yl)-bis(2-methylpropyl)alumane is sourced from PubChem (CID 145373365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).