C26H19BN2O3 — CID 145373580
5-(11,17-diethyl-8,14,22-trioxa-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaen-5-yl)pyrimidine (PubChem CID 145373580) has the molecular formula C26H19BN2O3 and a molecular weight of 418.26 g/mol. Its IUPAC name is 5-(11,17-diethyl-8,14,22-trioxa-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaen-5-yl)pyrimidine.
| Compound Name | 5-(11,17-diethyl-8,14,22-trioxa-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaen-5-yl)pyrimidine |
|---|---|
| PubChem CID | 145373580 |
| Molecular Formula | C26H19BN2O3 |
| Molecular Weight | 418.26 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 5-(11,17-diethyl-8,14,22-trioxa-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaen-5-yl)pyrimidine |
| SMILES | CCc1cc2c3c(c1)Oc1cc(-c4cncnc4)cc4c1B3c1c(cc(CC)cc1O4)O2 |
| InChI | InChI=1S/C26H19BN2O3/c1-3-14-5-18-24-20(7-14)31-22-9-16(17-11-28-13-29-12-17)10-23-26(22)27(24)25-19(30-18)6-15(4-2)8-21(25)32-23/h5-13H,3-4H2,1-2H3 |
| InChIKey | YXZOIFYAUNDOFA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.26 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|