C14H21IN2 — CID 145373801
[(2E,4Z)-1-iodohepta-2,4-dien-3-yl]-(4-methylcyclohex-2-en-1-yl)diazene (PubChem CID 145373801) has the molecular formula C14H21IN2 and a molecular weight of 344.24 g/mol. Its IUPAC name is [(2E,4Z)-1-iodohepta-2,4-dien-3-yl]-(4-methylcyclohex-2-en-1-yl)diazene.
| Compound Name | [(2E,4Z)-1-iodohepta-2,4-dien-3-yl]-(4-methylcyclohex-2-en-1-yl)diazene |
|---|---|
| PubChem CID | 145373801 |
| Molecular Formula | C14H21IN2 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | [(2E,4Z)-1-iodohepta-2,4-dien-3-yl]-(4-methylcyclohex-2-en-1-yl)diazene |
| SMILES | CC/C=C\C(=C/CI)\N=N\C1C=CC(C)CC1 |
| InChI | InChI=1S/C14H21IN2/c1-3-4-5-13(10-11-15)16-17-14-8-6-12(2)7-9-14/h4-6,8,10,12,14H,3,7,9,11H2,1-2H3/b5-4-,13-10+,17-16+ |
| InChIKey | HUXYUTSEELNHJQ-KBDWNFPASA-N |
| XLogP | 5.08 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|