C48H41N3 — CID 145373895
3-[(1Z,3Z,5E,7Z,9Z,11E)-12-aminododeca-1,3,5,7,9,11-hexaenyl]-N,N-diphenyl-5-(9-phenyl-4b,5-dihydrocarbazol-3-yl)aniline (PubChem CID 145373895) has the molecular formula C48H41N3 and a molecular weight of 659.88 g/mol. Its IUPAC name is 3-[(1Z,3Z,5E,7Z,9Z,11E)-12-aminododeca-1,3,5,7,9,11-hexaenyl]-N,N-diphenyl-5-(9-phenyl-4b,5-dihydrocarbazol-3-yl)aniline.
| Compound Name | 3-[(1Z,3Z,5E,7Z,9Z,11E)-12-aminododeca-1,3,5,7,9,11-hexaenyl]-N,N-diphenyl-5-(9-phenyl-4b,5-dihydrocarbazol-3-yl)aniline |
|---|---|
| PubChem CID | 145373895 |
| Molecular Formula | C48H41N3 |
| Molecular Weight | 659.88 g/mol |
| Exact Mass | 659.33 |
| IUPAC Name | 3-[(1Z,3Z,5E,7Z,9Z,11E)-12-aminododeca-1,3,5,7,9,11-hexaenyl]-N,N-diphenyl-5-(9-phenyl-4b,5-dihydrocarbazol-3-yl)aniline |
| SMILES | N/C=C/C=C\C=C/C=C/C=C\C=C/c1cc(-c2ccc3c(c2)C2CC=CC=C2N3c2ccccc2)cc(N(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C48H41N3/c49-33-21-8-6-4-2-1-3-5-7-12-22-38-34-40(36-44(35-38)50(41-23-13-9-14-24-41)42-25-15-10-16-26-42)39-31-32-48-46(37-39)45-29-19-20-30-47(45)51(48)43-27-17-11-18-28-43/h1-28,30-37,45H,29,49H2/b3-1+,4-2-,7-5-,8-6-,22-12-,33-21+ |
| InChIKey | WVDFQALOYAIJTB-UMEWEWTKSA-N |
| XLogP | 12.61 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.88 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|