C16H24F4O3 — CID 145374970
ethane;propane;(2,3,5,6-tetrafluorophenyl) 3-hydroxy-2,2-dimethylpropanoate (PubChem CID 145374970) has the molecular formula C16H24F4O3 and a molecular weight of 340.36 g/mol. Its IUPAC name is ethane;propane;(2,3,5,6-tetrafluorophenyl) 3-hydroxy-2,2-dimethylpropanoate.
| Compound Name | ethane;propane;(2,3,5,6-tetrafluorophenyl) 3-hydroxy-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 145374970 |
| Molecular Formula | C16H24F4O3 |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | ethane;propane;(2,3,5,6-tetrafluorophenyl) 3-hydroxy-2,2-dimethylpropanoate |
| SMILES | CC.CC(C)(CO)C(=O)Oc1c(F)c(F)cc(F)c1F.CCC |
| InChI | InChI=1S/C11H10F4O3.C3H8.C2H6/c1-11(2,4-16)10(17)18-9-7(14)5(12)3-6(13)8(9)15;1-3-2;1-2/h3,16H,4H2,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | MXOSJGAAEZCNIZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|