C24H46O7Si2 — CID 145375798
methyl 2-[(2S,3R,4S,4aS,6R,8aS)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-formyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetate (PubChem CID 145375798) has the molecular formula C24H46O7Si2 and a molecular weight of 502.80 g/mol. Its IUPAC name is methyl 2-[(2S,3R,4S,4aS,6R,8aS)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-formyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetate.
| Compound Name | methyl 2-[(2S,3R,4S,4aS,6R,8aS)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-formyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetate |
|---|---|
| PubChem CID | 145375798 |
| Molecular Formula | C24H46O7Si2 |
| Molecular Weight | 502.80 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | methyl 2-[(2S,3R,4S,4aS,6R,8aS)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-formyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetate |
| SMILES | COC(=O)C[C@H]1CC[C@@H]2O[C@H](C=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C24H46O7Si2/c1-23(2,3)32(8,9)30-21-18(15-25)29-17-13-12-16(14-19(26)27-7)28-20(17)22(21)31-33(10,11)24(4,5)6/h15-18,20-22H,12-14H2,1-11H3/t16-,17+,18-,20+,21-,22+/m1/s1 |
| InChIKey | ZYNWEACDIJVCOX-GXVZMRFDSA-N |
| XLogP | 4.84 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.80 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|